No products
View larger ATP2040L
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $46.75 | Total: $233.75 |
| 1 | 10 | $39.60 | Total: $396.00 |
| 1 | 25 | $33.55 | Total: $838.75 |
| 1 | 50 | $28.60 | Total: $1,430.00 |
| 1 | 100 | $24.75 | Total: $2,475.00 |
| Molecular Formula | C101H159N31O25 |
| Molecular Weight | 2207.58 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | O=C(C)O.O=C(NCC(NCC(N[C@@H](CC1=CC=CC=C1)C(N[C@@H](CC(C)C)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCNC(N)=N)C(N[C@@H]([C@@H](C)CC)C(N[C@@H](CCCNC(N)=N)C(N2[C@@H](CCC2)C(N[C@@H](CCCCN)C(N[C@@H](CC(C)C)C(N[C@@H](CCCCN)C(N[C@@H](CC3=CNC4=CC=CC=C34)C(N[C@@H](CC(O)=O)C(N[C@@H](CC(N)=O)C(N[C@@H](CCC(N)=O)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CC5=CC=C(C=C5)O)N |
| References | Dhawan et al [1996] International union of pharmacology XII. Classification of opioid receptors. Pharmacol.Rev. 48 567 PMID |