No products
View larger AOB17937
CAS: 2101315-36-8
Chemical Name: 2-Ethyl-1-(2-(((1R,2S,5R)-2-isopropyl-5-methylcyclohexyl)oxy)-2-oxoethyl)-3-methyl-1H-benzo[d]imidazol-3-ium chloride
1100 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.88 | Total: $159.38 |
| 1 | 10 | $27.00 | Total: $270.00 |
| 1 | 25 | $22.88 | Total: $571.88 |
| 1 | 50 | $19.50 | Total: $975.00 |
| 1 | 100 | $16.88 | Total: $1,687.50 |
| Molecular Formula | C22H33ClN2O2 |
| Molecular Weight | 398.97 |
| CAS Numbers | 2101315-36-8 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Gboxin; Gboxin chloride |
| IUPAC/Chemical Name | 2-Ethyl-1-(2-(((1R,2S,5R)-2-isopropyl-5-methylcyclohexyl)oxy)-2-oxoethyl)-3-methyl-1H-benzo[d]imidazol-3-ium chloride |
| InChl Key | UBWVTCCKVGOTBG-VYZBTARASA-M |
| InChl Code | InChI=1S/C22H33N2O2.ClH/c1-6-21-23(5)18-9-7-8-10-19(18)24(21)14-22(25)26-20-13-16(4)11-12-17(20)15(2)3;/h7-10,15-17,20H,6,11-14H2,1-5H3;1H/q+1;/p-1/t16-,17+,20-;/m1./s1 |
| SMILES Code | C[N+]1=C(CC)N(CC(O[C@H]2[C@H](C(C)C)CC[C@@H](C)C2)=O)C3=CC=CC=C31.[Cl-] |
| References | Shi Y, Lim SK, Liang Q, Iyer SV, Wang HY, Wang Z, Xie X, Sun D, Chen YJ, Tabar V, Gutin P, Williams N, De Brabander JK, Parada LF. Gboxin is an oxidative phosphorylation inhibitor that targets glioblastoma. Nature. 2019 Mar 6 |
Novel specific oxidative phosphorylation inhibitor, targeting glioblastoma and rapidly and irreversibly compromising oxygen consumption in glioblastoma cells