No products
View larger AOB31001
CAS: 313254-94-3
Chemical Name: Ethyl 5-[2-oxo-2-(2,3,4-trihydroxyphenyl)ethyl]furan-2-carboxylate
51 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $101.58 | Total: $507.88 |
| 1 | 10 | $86.04 | Total: $860.40 |
| 1 | 25 | $72.90 | Total: $1,822.38 |
| 1 | 50 | $62.14 | Total: $3,107.00 |
| 1 | 100 | $53.78 | Total: $5,377.50 |
| Molecular Formula | C15H14O7 |
| Molecular Weight | 306.27 |
| CAS Numbers | 313254-94-3 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | MMG11; MMG 11; MMG-11 |
| IUPAC/Chemical Name | Ethyl 5-[2-oxo-2-(2,3,4-trihydroxyphenyl)ethyl]furan-2-carboxylate |
| InChl Key | IIDUJWIVMGALOG-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C15H14O7/c1-2-21-15(20)12-6-3-8(22-12)7-11(17)9-4-5-10(16)14(19)13(9)18/h3-6,16,18-19H,2,7H2,1H3 |
| SMILES Code | O=C(C1=CC=C(CC(C2=CC=C(O)C(O)=C2O)=O)O1)OCC |
| References | 1) Grabowski M, Murgueitio MS, Bermudez M, Rademann J, Wolber G, Weindl G. Identification of a pyrogallol derivative as a potent and selective human TLR2 antagonist by structure-based virtual screening. Biochem Pharmacol. 2018 Aug;154:148-160. |
| PubChem ID | 29684378 |
Novel potent and selective dual inhibitor of TLR2/1 and TLR2/6 signaling with low cytotoxicity