No products
View larger AOB13385
CAS: 1990478-58-4
Chemical Name: N2-(3,4-Dimethylphenyl)-6-((4-(p-tolyl)piperazin-1-yl)methyl)-1,3,5-triazine-2,4-diamine
7976 Items
This product is discontinued due to commercial reason
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $0.00 | Total: $0.00 |
| 1 | 10 | $0.00 | Total: $0.00 |
| 1 | 25 | $0.00 | Total: $0.00 |
| 1 | 50 | $0.00 | Total: $0.00 |
| 1 | 100 | $0.00 | Total: $0.00 |
| Molecular Formula | C23H29N7 |
| Molecular Weight | 403.53 |
| CAS Numbers | 1990478-58-4 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | GLX481372; GLX-481372; GLX 481372 |
| IUPAC/Chemical Name | N2-(3,4-Dimethylphenyl)-6-((4-(p-tolyl)piperazin-1-yl)methyl)-1,3,5-triazine-2,4-diamine |
| InChl Key | BZFYMFCKLUAOET-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C23H29N7/c1-16-4-8-20(9-5-16)30-12-10-29(11-13-30)15-21-26-22(24)28-23(27-21)25-19-7-6-17(2)18(3)14-19/h4-9,14H,10-13,15H2,1-3H3,(H3,24,25,26,27,28) |
| SMILES Code | NC1=NC(CN2CCN(C3=CC=C(C)C=C3)CC2)=NC(NC4=CC=C(C)C(C)=C4)=N1 |
| References | Wang, X et al. The novel NADPH oxidase 4 selective inhibitor GLX7013114 counteracts human islet cell death in vitro, PLoS One. 2018; 13(9): e0204271. |
Novel potent and selective NADPH oxidase inhibitor, targeting Nox4 in TGFβ-induced lens epithelial to mesenchymal transition