No products
View larger AOB13114
CAS: 154617-50-2
Chemical Name: (Z)-5-(2,5-Dimethoxybenzylidene)thiazolidine-2,4-dione
13 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $194.65 | Total: $973.25 |
| 1 | 10 | $164.88 | Total: $1,648.80 |
| 1 | 25 | $139.69 | Total: $3,492.25 |
| 1 | 50 | $119.08 | Total: $5,954.00 |
| 1 | 100 | $103.05 | Total: $10,305.00 |
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.28 |
| CAS Numbers | 154617-50-2 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 95% by HPLC |
| Synonym | GW-450863X, GW 450863X |
| IUPAC/Chemical Name | (Z)-5-(2,5-Dimethoxybenzylidene)thiazolidine-2,4-dione |
| InChl Key | BTVXGOPTTYYHOK-POHAHGRESA-N |
| InChl Code | InChI=1S/C12H11NO4S/c1-16-8-3-4-9(17-2)7(5-8)6-10-11(14)13-12(15)18-10/h3-6H,1-2H3,(H,13,14,15)/b10-6- |
| SMILES Code | O=C(NC/1=O)SC1=C/C2=CC(OC)=CC=C2OC |
| References | 1) John C.W. et al. Identification and characterisation of a new class of highly specific and potent inhibitors of the mitochondrial pyruvate carrier, Biochimica et Biophysica Acta (BBA) - Bioenergetics 1707:221 (2005). doi.org/10.1016/j.bbabio.2004.12.005 |
Novel potent and selective inhibitor of mitochondrial respiration supported by pyruvate