No products
View larger AOB446022339
CAS: 446022-33-9
Chemical Name: (S)-2-(5-(2-((S)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropyrido[2,3-d]pyrimidin-6-yl)ethyl)-4-methylthiophene-2-carboxamido)pentanedioic acid
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $101.15 | Total: $505.75 |
| 1 | 10 | $85.68 | Total: $856.80 |
| 1 | 25 | $72.59 | Total: $1,814.75 |
| 1 | 50 | $61.88 | Total: $3,094.00 |
| 1 | 100 | $53.55 | Total: $5,355.00 |
| Molecular Formula | C20H25N5O6S |
| Molecular Weight | 463.51 |
| CAS Numbers | 446022-33-9 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 99% (HPLC) |
| Synonym | AG-2037; AG 2037; AG2037; Pelitrexol. |
| IUPAC/Chemical Name | (S)-2-(5-(2-((S)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropyrido[2,3-d]pyrimidin-6-yl)ethyl)-4-methylthiophene-2-carboxamido)pentanedioic acid |
| InChl Key | QXOPTIPQEVJERB-JQWIXIFHSA-N |
| InChl Code | InChI=1S/C20H25N5O6S/c1-9-6-14(18(29)23-12(19(30)31)3-5-15(26)27)32-13(9)4-2-10-7-11-16(22-8-10)24-20(21)25-17(11)28/h6,10,12H,2-5,7-8H2,1H3,(H,23,29)(H,26,27)(H,30,31)(H4,21,22,24,25,28)/t10-,12-/m0/s1 |
| SMILES Code | O=C(O)[C@@H](NC(C1=CC(C)=C(CC[C@H](CN2)CC3=C2N=C(N)NC3=O)S1)=O)CCC(O)=O |
| References | 1) Frost, Gregory I.; Jiang, Ping; Thompson, Curtis B. Modified hyaluronidases and uses in treating hyaluronan-associated diseases and conditions. PCT Int. Appl. (2009), 292 pp. CODEN: PIXXD2 WO 2009128917 A2 20091022 CAN 151:462825 AN 2009:1297488 2) Czarnik, Anthony W. Deuterium-enriched pelitrexol. U.S. Pat. Appl. Publ. (2009), 10pp. CODEN: USXXCO US 2009062316 A1 20090305 CAN 150:314122 AN 2009:270615 |
A GARFT inhibitor that has a water soluble antifolate with anti-proliferative activity.