No products
View larger AOB36907
CAS: 2280874-34-0
Chemical Name: PHVA; (S)-2-((S)-2-amino-3-phenylpropanamido)-N-(4-((3-guanidinopropyl)amino)butyl)-3-methylbutanamide
999 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $12.75 | Total: $63.75 |
| 1 | 10 | $10.80 | Total: $108.00 |
| 1 | 25 | $9.15 | Total: $228.75 |
| 1 | 50 | $7.80 | Total: $390.00 |
| 1 | 100 | $6.75 | Total: $675.00 |
| Molecular Formula | C22H39N7O2 |
| Molecular Weight | 433.60 |
| CAS Numbers | 2280874-34-0 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Phevamine A; PHVA |
| IUPAC/Chemical Name | (S)-2-((S)-2-amino-3-phenylpropanamido)-N-(4-((3-guanidinopropyl)amino)butyl)-3-methylbutanamide |
| InChl Key | UNPKFBJCYYQNKC-OALUTQOASA-N |
| InChl Code | InChI=1S/C22H39N7O2/c1-16(2)19(29-20(30)18(23)15-17-9-4-3-5-10-17)21(31)27-13-7-6-11-26-12-8-14-28-22(24)25/h3-5,9-10,16,18-19,26H,6-8,11-15,23H2,1-2H3,(H,27,31)(H,29,30)(H4,24,25,28)/t18-,19-/m0/s1 |
| SMILES Code | CC(C)[C@H](NC([C@@H](N)CC1=CC=CC=C1)=O)C(NCCCCNCCCNC(N)=N)=O |
| References | 1) O'Neill EM, Mucyn TS, Patteson JB, Finkel OM, Chung EH, Baccile JA, Massolo E, Schroeder FC, Dangl JL, Li B. Phevamine A, a small molecule that suppresses plant immune responses. Proc Natl Acad Sci U S A. 2018 Oct 9;115(41):E9514-E9522. doi: 10.1073/pnas.1803779115. Epub 2018 Sep 20. PubMed PMID: 30237288; PubMed Central PMCID: PMC6187163. |
Novel suppressor of plant immune responses