No products
View larger AOB8511
CAS: 1818885-28-7
Chemical Name: OTX015-Pomalidomide conjugate; 2-((S)-4-(4-Chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-6-yl)-N-(4-(2-(2-(2-(2-((2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)amino)ethoxy)ethoxy)ethoxy)ethoxy)-phenyl)acetamide
1000 Items
| Quantity (mg or Unit) | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|
| 5 | $24.65 | Total: $123.25 |
| 10 | $20.88 | Total: $208.80 |
| 25 | $17.69 | Total: $442.25 |
| 50 | $15.08 | Total: $754.00 |
| 100 | $13.05 | Total: $1,305.00 |
| Molecular Formula | C46H47ClN8O9S |
| Molecular Weight | 923.43 |
| CAS Numbers | 1818885-28-7 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Stock Solution Guide | DMSO 50 mg per mL (54.15 mM) |
| Purity | 98% by HPLC |
| Synonym | ARV825; ARV 825 |
| IUPAC/Chemical Name | 2-((S)-4-(4-chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-6-yl)-N-(4-(2-(2-(2-(2-((2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)amino)ethoxy)ethoxy)ethoxy)ethoxy)phenyl)acetamide |
| InChl Key | RWLOGRLTDKDANT-TYIYNAFKSA-N |
| InChl Code | InChI=1S/C46H47ClN8O9S/c1-26-27(2)65-46-39(26)41(29-7-9-30(47)10-8-29)50-35(42-53-52-28(3)54(42)46)25-38(57)49-31-11-13-32(14-12-31)64-24-23-63-22-21-62-20-19-61-18-17-48-34-6-4-5-33-40(34)45(60)55(44(33)59)36-15-16-37(56)51-43(36)58/h4-14,35-36,48H, |
| SMILES Code | CC1=NN=C2[C@H](CC(NC3=CC=C(OCCOCCOCCOCCNC4=C(C(N(C5C(NC(CC5)=O)=O)C6=O)=O)C6=CC=C4)C=C3)=O)N=C(C7=CC=C(Cl)C=C7)C8=C(SC(C)=C8C)N21 |
| References | 1) Lu J, et al. Hijacking the E3 Ubiquitin Ligase Cereblon to Efficiently Target BRD4. Chem Biol. 22:755-63 (2015). |
Novel PROTAC consisting of OTX015 (a classic BRD4 binding moiety) and pomalidomide (a third-generation immunomodulatory drug binding to the E3 ubiquitin ligase)