No products
View larger AOB31535
CAS: 1184173-73-6
Chemical Name: SCH900353; (S)-N-(3-(6-Isopropoxypyridin-3-yl)-1H-indazol-5-yl)-1-(2-(4-(4-(1-methyl-1H-1,2,4-triazol-3-yl)phenyl)-3,6-dihydropyridin-1(2H)-yl)-2-oxoethyl)-3-(methylthio)pyrrolidine-3-carboxamide
998 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $50.15 | Total: $250.75 |
| 1 | 10 | $42.48 | Total: $424.80 |
| 1 | 25 | $35.99 | Total: $899.75 |
| 1 | 50 | $30.68 | Total: $1,534.00 |
| 1 | 100 | $26.55 | Total: $2,655.00 |
| Molecular Formula | C37H41N9O3S |
| Molecular Weight | 691.86 |
| CAS Numbers | 1184173-73-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | SCH900353; SCH-900353; SCH 900353; MK-8353; MK 8353; MK8353. |
| IUPAC/Chemical Name | (S)-N-(3-(6-isopropoxypyridin-3-yl)-1H-indazol-5-yl)-1-(2-(4-(4-(1-methyl-1H-1,2,4-triazol-3-yl)phenyl)-3,6-dihydropyridin-1(2H)-yl)-2-oxoethyl)-3-(methylthio)pyrrolidine-3-carboxamide |
| InChl Key | KPQQGHGDBBJGFA-QNGWXLTQSA-N |
| InChl Code | InChI=1S/C37H41N9O3S/c1-24(2)49-32-12-9-28(20-38-32)34-30-19-29(10-11-31(30)41-42-34)40-36(48)37(50-4)15-18-45(22-37)21-33(47)46-16-13-26(14-17-46)25-5-7-27(8-6-25)35-39-23-44(3)43-35/h5-13,19-20,23-24H,14-18,21-22H2,1-4H3,(H,40,48)(H,41,42)/t37-/m0/s1 |
| SMILES Code | O=C(CN1CC[C@@](SC)(C(NC2=CC=C(NN=C3C4=CC=C(OC(C)C)N=C4)C3=C2)=O)C1)N5CCC(C6=CC=C(C7=NN(C)C=N7)C=C6)=CC5 |
| References | 1) Moschos SJ, et al., Development of MK-8353, an orally administered ERK1/2 inhibitor, in patientswith advanced solid tumors. JCI Insight. 2018 Feb 22;3(4). pii: 92352. doi: 10.1172/jci.insight.92352. [Epub ahead of print] PubMed PMID: 29467321. |
Novel highly potent, orally bioavailable, dual-specificity ERK1/2 inhibitor, inducing tumor growth inhibition or regression across various human cancer xenograft models