No products
View larger AOB5754
CAS No: 871307-18-5
Chemical Name: 4-[(3-Chloro-4-fluorophenyl)amino]-6-[(3-pyridinylmethyl)amino]-1,7-naphthyridine-3-carbonitrile
3000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $19.13 | Total: $95.63 |
| 1 | 10 | $16.20 | Total: $162.00 |
| 1 | 25 | $13.73 | Total: $343.13 |
| 1 | 50 | $11.70 | Total: $585.00 |
| 1 | 100 | $10.13 | Total: $1,012.50 |
| Molecular Formula | C21H14ClFN6 |
| Molecular Weight | 404.83 |
| CAS Numbers | 871307-18-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | 40.5mg / mL in DMSO |
| Purity | 99% (HPLC) |
| IUPAC/Chemical Name | 4-[(3-chloro-4-fluorophenyl)amino]-6-[(3-pyridinylmethyl)amino]-1,7-naphthyridine-3-carbonitrile |
| InChl Key | NMEUKWOOQOHUNA-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C21H14ClFN6/c22-17-6-15(3-4-18(17)23)29-21-14(8-24)11-26-19-12-28-20(7-16(19)21)27-10-13-2-1-5-25-9-13/h1-7,9,11-12H,10H2,(H,26,29)(H,27,28) |
| SMILES Code | FC(C=C1)=C(Cl)C=C1NC2=C(C#N)C=NC(C=N3)=C2C=C3NCC4=CN=CC=C4 |
| References | 1) Garvin, L.K., Green, N., Hu, Y., et al. Inhibition of Tpl2 kinase and TNF-α production with 1,7-naphthyridine-3-carbonitriles: Synthesis and structure-activity relationships. Bioor. Med. Chem. Lett. 15(23), 5288-5292 (2005). |
Potent and selective Tpl2 (Cot; MAP3K8) inhibitor