No products
View larger AOB1551
CAS: 573965-48-7
Chemical Name: [2-(1-Adamantylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate; T5217128; ML-151
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $24.65 | Total: $123.25 |
| 1 | 10 | $20.88 | Total: $208.80 |
| 1 | 25 | $17.69 | Total: $442.25 |
| 1 | 50 | $15.08 | Total: $754.00 |
| 1 | 100 | $13.05 | Total: $1,305.00 |
| Molecular Formula | C20H24N2O7S |
| Molecular Weight | 436.48 |
| CAS Numbers | 573965-48-7 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | T5217128; ML-151; ML 151 |
| IUPAC/Chemical Name | [2-(1-Adamantylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate; |
| InChl Key | BTXTVUJWNPMQBT-UHFFFAOYSA-N |
| InChl Code | 1S/C20H24N2O7S/c1-30(27,28)17-3-2-15(7-16(17)22(25)26)19(24)29-11-18(23)21-20-8-12-4-13(9-20)6-14(5-12)10-20/h2-3,7,12-14H,4-6,8-11H2,1H3,(H,21,23) |
| SMILES Code | CS(=O)(=O)c1ccc(cc1[N+]([O-])=O)C(=O)OCC(=O)NC23CC4CC(CC(C4)C2)C3 |
Inhibitor of the interaction of Thyroid_hormone_receptor>thyroid hormone receptor and steroid receptor coregulator 2