No products
View larger AOB17995
CAS: 339586-49-1 (free base)
Chemical Name: 4-{2-[(3,4-Dimethylphenyl)amino]-1,3-thiazol-4-yl}-N,N-diethylbenzene-1-sulfonamide Hydrobromide
998 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $50.15 | Total: $250.75 |
| 1 | 10 | $42.48 | Total: $424.80 |
| 1 | 25 | $35.99 | Total: $899.75 |
| 1 | 50 | $30.68 | Total: $1,534.00 |
| 1 | 100 | $26.55 | Total: $2,655.00 |
| Molecular Formula | C21H26BrN3O2S2 |
| Molecular Weight | 496.48 |
| CAS Numbers | 339586-49-1 (free base) |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | MMV-009108; MMV 009108; MMV009108 |
| IUPAC/Chemical Name | 4-{2-[(3,4-Dimethylphenyl)amino]-1,3-thiazol-4-yl}-N,N-diethylbenzene-1-sulfonamide Hydrobromide |
| InChl Key | CFAYJTHICHSZHC-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C21H25N3O2S2/c1-5-24(6-2)28(25,26)19-11-8-17(9-12-19)20-14-27-21(23-20)22-18-10-7-15(3)16(4)13-18/h7-14H,5-6H2,1-4H3,(H,22,23) |
| SMILES Code | O=S(C1=CC=C(C2=CSC(NC3=CC=C(C)C(C)=C3)=N2)C=C1)(N(CC)CC)=O |
| References | 1) Avantika I. Ahiya et al., Dramatic Consequences of Reducing Erythrocyte Membrane Cholesterol on Plasmodium falciparum; ASM Journals Microbiology Spectrum Vol. 10, No. 1 DOI: https://doi.org/10.1128/spectrum.00158-22 |
Novel antimalarial agent with increased efficacy against one or more pfatp4 mutated clones