No products
View larger AOB13160
CAS: 491585-87-6
Chemical Name: ES5; Endosidin5; (E)-N'-((1H-Pyrrol-2-yl)methylene)-3,7-dimethylquinoline-2-carbohydrazide
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.85 | Total: $89.25 |
| 1 | 10 | $15.12 | Total: $151.20 |
| 1 | 25 | $12.81 | Total: $320.25 |
| 1 | 50 | $10.92 | Total: $546.00 |
| 1 | 100 | $9.45 | Total: $945.00 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 |
| CAS Numbers | 491585-87-6 |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Endosidin5; Endosidin-5 Endosidin 5 |
| IUPAC/Chemical Name | (E)-N'-((1H-Pyrrol-2-yl)methylene)-3,7-dimethylquinoline-2-carbohydrazide |
| InChl Key | BAVAATSCBJHSNI-VXLYETTFSA-N |
| InChl Code | InChI=1S/C17H16N4O/c1-11-5-6-13-9-12(2)16(20-15(13)8-11)17(22)21-19-10-14-4-3-7-18-14/h3-10,18H,1-2H3,(H,21,22)/b19-10+ |
| SMILES Code | O=C(C1=NC2=CC(C)=CC=C2C=C1C)N/N=C/C3=CC=CN3 |
| References | 1) Josephine G LoRicco, et al.; Endosidin 5 disruption of the Golgi apparatus and extracellular matrix secretion in the unicellular charophyte Penium margaritaceum, Annals of Botany, Volume 131, Issue 6, 9 May 2023, Pages 967–983 |
Novel exocytosis inhibitor, disrupting the Golgi apparatus and extracellular matrix secretion in the unicellular charophyte Penium margaritaceum, blocking proteins recycling from plasma membrane