No products
View larger AOB11429
CAS: 852223-50-8
Chemical Name: N-(2-Morpholin-4-ylethyl)-3-nitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzenesulfonamide
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $109.65 | Total: $548.25 |
| 1 | 10 | $92.88 | Total: $928.80 |
| 1 | 25 | $78.69 | Total: $1,967.25 |
| 1 | 50 | $67.08 | Total: $3,354.00 |
| 1 | 100 | $58.05 | Total: $5,805.00 |
| Molecular Formula | C19H21N7O5S2 |
| Molecular Weight | 491.54 |
| CAS Numbers | 852223-50-8 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | MLS 000394177; MLS-000394177; ZINC000025784472 |
| IUPAC/Chemical Name | N-(2-Morpholin-4-ylethyl)-3-nitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzenesulfonamide |
| InChl Key | PWYCXXIBNGYTHN-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C19H21N7O5S2/c27-26(28)17-14-16(33(29,30)20-8-9-24-10-12-31-13-11-24)6-7-18(17)32-19-21-22-23-25(19)15-4-2-1-3-5-15/h1-7,14,20H,8-13H2 |
| SMILES Code | C1COCCN1CCNS(=O)(=O)C2=CC(=C(C=C2)SC3=NN=NN3C4=CC=CC=C4)[N+](=O)[O-] |
| References | 1) Manu Anantpadma et al., Large-Scale Screening and Identification of Novel Ebola Virus and Marburg Virus Entry Inhibitors, Antimicrobial Agents and Chemotherapy Vol. 60, No. 8: 4471 (2016) |
Novel potent inhibitor of EBOV infection