No products
View larger AOB87781
CAS No:1086062-66-9
Chemical Name: Omipalisib
500 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.85 | Total: $89.25 |
| 1 | 10 | $15.12 | Total: $151.20 |
| 1 | 25 | $12.81 | Total: $320.25 |
| 1 | 50 | $10.92 | Total: $546.00 |
| 1 | 100 | $9.45 | Total: $945.00 |
| Molecular Formula | C25H17F2N5O3 |
| Molecular Weight | 505.5 |
| CAS Numbers | 1086062-66-9 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 99% (HPLC) |
| Synonym | GSK2126458; GSK-2126458; GSK 2126458; OmipalisibIUPAC/Chemical Name: InChi Key:InChi Code:SMILES Code: |
| IUPAC/Chemical Name | 2,4-difluoro-N-(2-methoxy-5-(4-(pyridazin-4-yl)quinolin-6-yl)pyridin-3-yl)benzenesulfonamide |
| InChl Key | CGBJSGAELGCMKE-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C25H17F2N5O3S/c1-35-25-23(32-36(33,34)24-5-3-18(26)12-21(24)27)11-17(13-29-25)15-2-4-22-20(10-15)19(7-8-28-22)16-6-9-30-31-14-16/h2-14,32H,1H3 |
| SMILES Code | O=S(C1=CC=C(F)C=C1F)(NC2=CC(C3=CC=C4N=CC=C(C5=CC=NN=C5)C4=C3)=CN=C2OC)=O |
A highly potent and orally bioavailable ATP-competitive inhibitor of PI3K and mTOR