No products
View larger AOB8370
CAS: 143984-17-2
Chemical Name: (2-((8-(Dimethylamino)octyl)thio)-6-isopropylpyridin-3-yl)(thiophen-2-yl)methanone Tosylate
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $21.25 | Total: $106.25 |
| 1 | 10 | $18.00 | Total: $180.00 |
| 1 | 25 | $15.25 | Total: $381.25 |
| 1 | 50 | $13.00 | Total: $650.00 |
| 1 | 100 | $11.25 | Total: $1,125.00 |
| Molecular Formula | C30H42N2O4S3 |
| Molecular Weight | 590.86 |
| CAS Numbers | 143984-17-2 (tosylate) |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Y 29794; Y-29794; Y29794; Y29794 tosylate; Y-29794 tosylate; Y 29794 tosylate. |
| IUPAC/Chemical Name | (2-((8-(dimethylamino)octyl)thio)-6-isopropylpyridin-3-yl)(thiophen-2-yl)methanone 4-methylbenzenesulfonate |
| SMILES Code | CC(C1=CC=C(C(C2=CC=CS2)=O)C(SCCCCCCCCN(C)C)=N1)C.CC3=CC=C(S(=O)(O)=O)C=C3 |
| References | 1) Kato A, Fukunari A, Sakai Y, Nakajima T. Prevention of amyloid-like deposition by a selective prolyl endopeptidase inhibitor, Y-29794, in senescence-accelerated mouse. J Pharmacol Exp Ther. 1997 Oct;283(1):328-35. PubMed PMID: 9336340. 2) Nakajima T, Ono Y, Kato A, Maeda J, Ohe T. Y-29794--a non-peptide prolyl endopeptidase inhibitor that can penetrate into the brain. Neurosci Lett. 1992 Jul 20;141(2):156-60. PubMed PMID: 1436628. |
Orally active, potent and specific non-peptide prolyl endopeptidase (PPCE) inhibitor