No products
View larger AOB13830
CAS: 701932-26-5
Chemical Name: Methyl 2-(2-(3-(3,4-dihydroxyphenyl)propanoyl)hydrazine-1-carbothioamido)-5-phenylthiophene-3-carboxylate
987 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $109.65 | Total: $548.25 |
| 1 | 10 | $92.88 | Total: $928.80 |
| 1 | 25 | $78.69 | Total: $1,967.25 |
| 1 | 50 | $67.08 | Total: $3,354.00 |
| 1 | 100 | $58.05 | Total: $5,805.00 |
| Molecular Formula | C22H21N3O5S2 |
| Molecular Weight | 471.55 |
| CAS Numbers | 701932-26-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO and Water |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | Methyl 2-(2-(3-(3,4-dihydroxyphenyl)propanoyl)hydrazine-1-carbothioamido)-5-phenylthiophene-3-carboxylate |
| InChl Key | GEOYTUHZFJZPSB-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C22H21N3O5S2/c1-30-21(29)15-12-18(14-5-3-2-4-6-14)32-20(15)23-22(31)25-24-19(28)10-8-13-7-9-16(26)17(27)11-13/h2-7,9,11-12,26-27H,8,10H2,1H3,(H,24,28)(H2,23,25,31) |
| SMILES Code | O=C(C1=C(NC(NNC(CCC2=CC=C(O)C(O)=C2)=O)=S)SC(C3=CC=CC=C3)=C1)OC |
Novel DNA polymerase inhibitor, inhibiting DNA replication in assays to assess global DNA synthesis or single-molecule bases by DNA fiber fluorography