No products
View larger AOB1540
CAS No: 1783987-83-6, 313505-85-0 (Free Base)
Chemical Name: 7,13-Bis[(4-nitrophenyl)methyl]-1,4
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $16.15 | Total: $80.75 |
| 1 | 10 | $13.68 | Total: $136.80 |
| 1 | 25 | $11.59 | Total: $289.75 |
| 1 | 50 | $9.88 | Total: $494.00 |
| 1 | 100 | $8.55 | Total: $855.00 |
| Molecular Formula | C24H32N4O7.2HCl |
| Molecular Weight | 561.46 |
| CAS Numbers | 1783987-83-6; 313505-85-0 (Free Base) |
| Storage Condition | -20°C |
| Solubility | 100 mM in DMSO |
| Synonym | VU 590 2HCl |
| IUPAC/Chemical Name | 7,13-bis(4-nitrobenzyl)-1,4,10-trioxa-7,13-diazacyclopentadecane, dihydrochloride |
| InChl Key | FRYYSUBAHIUBNJ-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C24H32N4O7.2ClH/c29-27(30)23-5-1-21(2-6-23)19-25-9-13-33-14-10-26(12-16-35-18-17-34-15-11-25)20-22-3-7-24(8-4-22)28(31)32;;/h1-8H,9-20H2;2*1H |
| SMILES Code | O=[N+](C(C=C1)=CC=C1CN2CCOCCOCCN(CCOCC2)CC3=CC=C([N+]([O-])=O)C=C3)[O-].Cl.Cl |
| References | 1) Hebert, S.C., Desir, G., Giebisch, G., et al. Molecular diversity and regulation of renal potassium channels. Physiol. Rev. 85(1), 319-371 (2005). 2) Edwards, A.O. Clinical features of the congenital vitreoretinopathies. Eye (Lond) 22(10), 1233-1242 (2008). |
Inhibitor of ROMK and Kir7.1