No products
View larger AOB16406
CAS 1931946-73-4
Chemical Name: PC945; 4-(4-(4-(((3R,5R)-5-((1H-1,2,4-Triazol-1-yl)methyl)-5-(2,4-difluorophenyl)tetrahydrofuran-3-yl)methoxy)-3-methylphenyl)piperazin-1-yl)-N-(4-fluorophenyl)benzamide
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $143.65 | Total: $718.25 |
| 1 | 10 | $121.68 | Total: $1,216.80 |
| 1 | 25 | $103.09 | Total: $2,577.25 |
| 1 | 50 | $87.88 | Total: $4,394.00 |
| 1 | 100 | $76.05 | Total: $7,605.00 |
| Molecular Formula | C38H37F3N6O3 |
| Molecular Weight | 682.75 |
| CAS Numbers | 1931946-73-4 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Opelconazole; Opelconazolum; Opelconazol; |
| IUPAC/Chemical Name | 4-(4-(4-(((3R,5R)-5-((1H-1,2,4-triazol-1-yl)methyl)-5-(2,4-difluorophenyl)tetrahydrofuran-3-yl)methoxy)-3-methylphenyl)piperazin-1-yl)-N-(4-fluorophenyl)benzamide |
| InChl Key | OSAMZQJKSCAOHA-CWRQMEKBSA-N |
| InChl Code | InChI=1S/C38H37F3N6O3/c1-26-18-33(46-16-14-45(15-17-46)32-9-2-28(3-10-32)37(48)44-31-7-4-29(39)5-8-31)11-13-36(26)49-21-27-20-38(50-22-27,23-47-25-42-24-43-47)34-12-6-30(40)19-35(34)41/h2-13,18-19,24-25,27H,14-17,20-23H2,1H3,(H,44,48)/t27-,38+/m1/s1 |
| SMILES Code | FC1=CC(F)=C(C=C1)[C@]2(C[C@@](COC3=C(C)C=C(N4CCN(C5=CC=C(C(NC6=CC=C(F)C=C6)=O)C=C5)CC4)C=C3)([H])CO2)CN7N=CN=C7 |
Novel Inhaled Antifungal Agent for the Treatment of Respiratory Fungal Infections