No products
View larger AOB16596
CAS: 2756333-39-6
Chemical Name: 6-Fluoro-5-[4-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $58.65 | Total: $293.25 |
| 1 | 10 | $49.68 | Total: $496.80 |
| 1 | 25 | $42.09 | Total: $1,052.25 |
| 1 | 50 | $35.88 | Total: $1,794.00 |
| 1 | 100 | $31.05 | Total: $3,105.00 |
| Molecular Formula | C21H22F2N6O2 |
| Molecular Weight | 428.44 |
| CAS Numbers | 2756333-39-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | AZD9574; AZD 9574 |
| IUPAC/Chemical Name | 6-Fluoro-5-[4-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES Code | O=C(C1=NC(F)=C(N2CCN(CC2)CC3=C(F)C4=C(N=C(C)C(N4)=O)C=C3)C=C1)NC |
| References | 1) Hybrid meeting divulges structures of drug candidates C&EN News (2022) |
Novel, potent, selective, and blood-brain barrier (BBB) penetrant PARP1 inhibitor