No products
View larger AOB5563
CAS No:70375-43-8
Chemical Name: N-Methyl-2,3-diphenyl-1,2,4-thiadiazol-5-imine hydrobromide
398 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $11.05 | Total: $55.25 |
| 1 | 10 | $9.36 | Total: $93.60 |
| 1 | 25 | $7.93 | Total: $198.25 |
| 1 | 50 | $6.76 | Total: $338.00 |
| 1 | 100 | $5.85 | Total: $585.00 |
| Molecular Formula | C15H14BrN3S |
| Molecular Weight | 348.26 |
| CAS Numbers | 70375-43-8 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | N-methyl-2,3-diphenyl-1,2,4-thiadiazol-5-imine;hydrobromide |
| InChl Key | YJYGOWVFDGULLL-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C15H13N3S.BrH/c1-16-15-17-14(12-8-4-2-5-9-12)18(19-15)13-10-6-3-7-11-13;/h2-11H,1H3;1H |
| SMILES Code | CN=C1N=C(N(S1)C2=CC=CC=C2)C3=CC=CC=C3.Br |
Allosteric agonist and antagonist of G-protein coupled receptors (GPCRs)