No products
View larger AOB87708
CAS No:937265-83-3
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $20.40 | Total: $102.00 |
| 1 | 10 | $17.28 | Total: $172.80 |
| 1 | 25 | $14.64 | Total: $366.00 |
| 1 | 50 | $12.48 | Total: $624.00 |
| 1 | 100 | $10.80 | Total: $1,080.00 |
| Molecular Formula | C29H27N7O4S |
| Molecular Weight | 569.63 |
| CAS Numbers | 937265-83-3 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | ONT-380 analog; HER2-Inhibitor-1 |
| IUPAC/Chemical Name | 6-[5-[(2-Methylsulfonylethylamino)methyl]furan-2-yl]-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]quinazolin-4-amine |
| InChl Key | QVMNYGOVNWWFKF-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C29H27N7O4S/c1-19-13-21(4-7-26(19)39-22-9-11-36-28(15-22)32-18-34-36)35-29-24-14-20(3-6-25(24)31-17-33-29)27-8-5-23(40-27)16-30-10-12-41(2,37)38/h3-9,11,13-15,17-18,30H,10,12,16H2,1-2H3,(H,31,33,35) |
| SMILES Code | CC1=C(OC2=CC3=NC=NN3C=C2)C=CC(NC4=C(C=C(C5=CC=C(CNCCS(C)(=O)=O)O5)C=C6)C6=NC=N4)=C1 |
| References | 1) Lyssikatos, J.P., et al. N4-phenyl-quinazoline-4-amine derivatives and related compounds as erbb type i receptor tyrosine kinase inhibitors for the treatment of hyperproliferative diseases. (2017). |
Novel inhibitor of epidermal growth factor receptor (ErbB)