No products
View larger AT63143
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $340.00 | Total: $1,700.00 |
| 1 | 10 | $288.00 | Total: $2,880.00 |
| 1 | 25 | $244.00 | Total: $6,100.00 |
| 1 | 50 | $208.00 | Total: $10,400.00 |
| 1 | 100 | $180.00 | Total: $18,000.00 |
| Molecular Formula | C23H25ClF2N4OS |
| Molecular Weight | 478.99 |
| CAS Numbers | 2375781-06-7 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | ClC1=C(NN=C1CSC=2NC(CC3CCCCC3)=C(CC)C(=O)N2)C4=CC(F)=C(F)C=C4 |
| References | Rui RM, et al. C6-structural optimizations of 2-aryl-1H-pyrazole-S-DABOs From anti-HIV to anti-DENV activity. Bioorg Chem. 2022;119 105494. |