No products
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $8.50 | Total: $42.50 |
| 1 | 10 | $7.20 | Total: $72.00 |
| 1 | 25 | $6.10 | Total: $152.50 |
| 1 | 50 | $5.20 | Total: $260.00 |
| 1 | 100 | $4.50 | Total: $450.00 |
| Molecular Formula | C37H48N6O5S2 |
| Molecular Weight | 720.96 |
| CAS Numbers | 155213-67-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | A-84538, ABT-538, NSC 693184, RTV |
| IUPAC/Chemical Name | (3S,4S,6S,9S)-4-hydroxy-12-methyl-9-(1-methylethyl)-13-[2-(1-methylethyl)-4-thiazolyl]-8,11-dioxo-3,6-bis(phenylmethyl)-2,7,10,12-tetraazatridecanoic acid, 5-thiazolylmethyl ester |
| InChl Key | NCDNCNXCDXHOMX-XGKFQTDJSA-N |
| InChl Code | InChI=1S/C37H48N6O5S2/c1-24(2)33(42-36(46)43(5)20-29-22-49-35(40-29)25(3)4)34(45)39-28(16-26-12-8-6-9-13-26)18-32(44)31(17-27-14-10-7-11-15-27)41-37(47)48-21-30-19-38-23-50-30/h6-15,19,22-25,28,31-33,44H,16-18,20-21H2,1-5H3,(H,39,45)(H,41,47)(H,42,46 |
| SMILES Code | O[C@H]([C@@H](NC(OCC1=CN=CS1)=O)CC2=CC=CC=C2)C[C@@H](NC([C@H](C(C)C)NC(N(C)CC3=CSC(C(C)C)=N3)=O)=O)CC4=CC=CC=C4 |
| References | 1) Kempf, D.J., Shan, H.L., Marsh, K.C., et al. Discovery of ritonavir, a potent inhibitor of HIV protease with high oral bioavailability and clinical efficacy. Journal of Medicinal Chemistry 41(4), 602-617 (1998). 2) Koh, Y., Nakata, H., Maeda, K., et al. Novel bis-tetrahydrofuranylurethane-containing nonpeptidic protease inhibitor (PI) UIC-94017 (TMC114) with potent activity against multi-PI-resistant human immunodeficiency virus in vitro. Antimicrob. Agents Chemother. 47(10), 3123-3129 (2003). |