No products
View larger AOB5395
CAS 30572-42-0
Chemical Name: p-Bromophenyl-ß-D-glucopyranoside
8000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.85 | Total: $89.25 |
| 1 | 10 | $15.12 | Total: $151.20 |
| 1 | 25 | $12.81 | Total: $320.25 |
| 1 | 50 | $10.92 | Total: $546.00 |
| 1 | 100 | $9.45 | Total: $945.00 |
| Molecular Formula | C12H15BrO6 |
| Molecular Weight | 335.15 |
| CAS Numbers | 30572-42-0 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO and Water |
| Purity | 98% by HPLC |
| Synonym | ß-pBrPh-Glc; ßpBrPhGlc; ß pBrPh Glc; Beta-pBrPh-Glc; p-Bromophenyl-ß-D-glucopyranoside; p-Bromophenyl-beta-D-glucopyranoside; |
| IUPAC/Chemical Name | (2S,3R,4S,5S,6R)-2-(4-bromophenoxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol |
| InChl Key | XKNTYHQVRMHDHY-RMPHRYRLSA-N |
| InChl Code | InChI=1S/C12H15BrO6/c13-6-1-3-7(4-2-6)18-12-11(17)10(16)9(15)8(5-14)19-12/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11-,12-/m1/s1 |
| SMILES Code | BrC1=CC=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C1 |
| References | 1) Capicciotti CJ, Kurach JD, Turner TR, Mancini RS, Acker JP, Ben RN. Small molecule ice recrystallization inhibitors enable freezing of human red blood cells with reduced glycerol concentrations. Sci Rep. 2015 Apr 8;5:9692. doi: 10.1038/srep09692. PubMed PMID: 25851700; PubMed Central PMCID: PMC4389209. |
Novel ice recrystallization inhibitor (IRI)