No products
View larger AOB17852
CAS: 2284589-16-6
Chemical Name: (E)-3-(3-(4-Hydroxyphenyl)-3-oxoprop-1-en-1-yl)benzonitrile
250 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.45 | Total: $157.25 |
| 1 | 10 | $26.64 | Total: $266.40 |
| 1 | 25 | $22.57 | Total: $564.25 |
| 1 | 50 | $19.24 | Total: $962.00 |
| 1 | 100 | $16.65 | Total: $1,665.00 |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.27 |
| CAS Numbers | 2284589-16-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | BAP2; BAP-2; BAP 2 |
| IUPAC/Chemical Name | (E)-3-(3-(4-Hydroxyphenyl)-3-oxoprop-1-en-1-yl)benzonitrile |
| InChl Key | IZCIYUNGVIXYJY-RUDMXATFSA-N |
| InChl Code | InChI=1S/C16H11NO2/c17-11-13-3-1-2-12(10-13)4-9-16(19)14-5-7-15(18)8-6-14/h1-10,18H/b9-4+ |
| SMILES Code | N#CC1=CC=CC(/C=C/C(C2=CC=C(O)C=C2)=O)=C1 |
| References | 1) Fumi Kozu et al., Isoflurane induces Art2-Rsp5-dependent endocytosis of Bap2 in yeast, FEBS Open Bio. 2021 Nov;11(11):3090-3100. doi: 10.1002/2211-5463.13302. Epub 2021 Sep 29 |
Novel inhibitor of protein disulfide isomerase (PDI)