No products
View larger AOB16433
CAS: 956965-61-0
Chemical Name: N-(2-(5-Methoxy-1H-indol-3-yl)ethyl)-2-((3,4,8,8-tetramethyl-2-oxo-9,10-dihydro-2H,8H-pyrano[2,3-f]chromen-5-yl)oxy)acetamide
991 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $58.65 | Total: $293.25 |
| 1 | 10 | $49.68 | Total: $496.80 |
| 1 | 25 | $42.09 | Total: $1,052.25 |
| 1 | 50 | $35.88 | Total: $1,794.00 |
| 1 | 100 | $31.05 | Total: $3,105.00 |
| Molecular Formula | C29H32N2O6 |
| Molecular Weight | 504.583 |
| CAS Numbers | 956965-61-0 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | N-(2-(5-methoxy-1H-indol-3-yl)ethyl)-2-((3,4,8,8-tetramethyl-2-oxo-2,8,9,10-tetrahydropyrano[2,3-f]chromen-5-yl)oxy)acetamide |
| InChl Key | ZDCXTKTVNQLRGC-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C29H32N2O6/c1-16-17(2)28(33)36-27-20-8-10-29(3,4)37-23(20)13-24(26(16)27)35-15-25(32)30-11-9-18-14-31-22-7-6-19(34-5)12-21(18)22/h6-7,12-14,31H,8-11,15H2,1-5H3,(H,30,32) |
| SMILES Code | COc1ccc2[nH]cc(CCNC(=O)COc3cc4OC(C)(C)CCc4c4oc(=O)c(C)c(C)c34)c2c1 |
| References | 1) Hiromasa Yoshioka et al., Identification of a Small Molecule That Enhances Ferroptosis via Inhibition of Ferroptosis Suppressor Protein 1 (FSP1), ACS Chem. Biol. 2022, 17, 2, 483–491 |
Novel inhibitor of ferroptosis suppressor protein 1 (FSP1), enhancing ferroptosis and the sensitivity of various cancer cells to GPX4 inhibitors