No products
View larger ATP1195
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $118.15 | Total: $590.75 |
| 1 | 10 | $100.08 | Total: $1,000.80 |
| 1 | 25 | $84.79 | Total: $2,119.75 |
| 1 | 50 | $72.28 | Total: $3,614.00 |
| 1 | 100 | $62.55 | Total: $6,255.00 |
| Molecular Formula | C51H84N16O21 |
| Molecular Weight | 1257.31 |
| CAS Numbers | 1208243-50-8 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CC(C)C[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H]1CCC(=O)N1)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(O)=O |
| References | Hache G, et al. ARA290, a Specific Agonist of ErythropoietinCD131 Heteroreceptor, Improves Circulating Endothelial Progenitors' Angiogenic Potential and Homing Ability. Shock. 2016 Oct;46[4] 390-7 |