No products
View larger ATP2221L
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $28.90 | Total: $144.50 |
| 1 | 10 | $24.48 | Total: $244.80 |
| 1 | 25 | $20.74 | Total: $518.50 |
| 1 | 50 | $17.68 | Total: $884.00 |
| 1 | 100 | $15.30 | Total: $1,530.00 |
| Molecular Formula | C51H88N20O17S |
| Molecular Weight | 1285.43 |
| CAS Numbers | 129025-96-3 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(NCC(NCC(N[C@H](C(O)=O)CCCNC(N)=N)=O)=O)=O)CC1=CC=CC=C1)=O)CS)=O)CO)=O)CO)=O)CCCNC(N)=N)=O)CCCNC(N)=N)=O)CC(C)C)=O)CO.CC(O)=O |
| References | King MS, Baertschi AJ. Physiological concentrations of atrial natriuretic factors with intact N-terminal sequences inhibit corticotropin-releasing factor-stimulated adrenocorticotropin secretion from cultured anterior pituitary cells. Endocrinology. 1989 Jan;124[1] 286-92. |