No products
View larger ATP1880L1
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $72.25 | Total: $361.25 |
| 1 | 10 | $61.20 | Total: $612.00 |
| 1 | 25 | $51.85 | Total: $1,296.25 |
| 1 | 50 | $44.20 | Total: $2,210.00 |
| 1 | 100 | $38.25 | Total: $3,825.00 |
| Molecular Formula | C79H123N25O16 |
| Molecular Weight | 1678.98 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | O=C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCCN)C(N[C@@H](CCCCN)C(N[C@@H](CC1=CNC2=CC=CC=C12)C(N[C@@H](CC(N)=O)C(N[C@@H](CCCCN)C(N[C@@H](CC3=CNC4=CC=CC=C34)C(N[C@@H](C)C(N[C@@H](CC(C)C)C(N[C@@H](CO)C(N[C@@H](CCCNC(N)=N)C(N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CC5=CC=CC=C5)N.CC(O)=O |
| References | Kenji, Kuwasako, and, et al. Purification and characterization of PAMP-12 [PAMP[9 |