No products
View larger ATP2318
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $96.05 | Total: $480.25 |
| 1 | 10 | $81.36 | Total: $813.60 |
| 1 | 25 | $68.93 | Total: $1,723.25 |
| 1 | 50 | $58.76 | Total: $2,938.00 |
| 1 | 100 | $50.85 | Total: $5,085.00 |
| Molecular Formula | C11H15F3N2O7 |
| Molecular Weight | 344.24 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C1C[C@H](NC1)C(=O)N[C@@H](CC(=O)O)C(=O)O.C(=O)(C(F)(F)F)O |
| References | Girardi M, Sherling MA, Filler RB, et al. Anti-inflammatory effects in the skin of thymosin-beta4 splice-variants. Immunology. 2003;109[1] 1-7. doi 10.1046j.1365-2567.2003.01616.x |