No products
View larger AT12503
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $139.40 | Total: $697.00 |
| 1 | 10 | $118.08 | Total: $1,180.80 |
| 1 | 25 | $100.04 | Total: $2,501.00 |
| 1 | 50 | $85.28 | Total: $4,264.00 |
| 1 | 100 | $73.80 | Total: $7,380.00 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.33 |
| CAS Numbers | 1177356-70-5 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | O[C@@]12C(N(CC1)C3=CC=CC=C3)=NC=4C(C2=O)=CC(C)=CC4 |
| References | Cristina Lucas?Lopez, et al. Absolute Stereochemical Assignment and Fluorescence Tuning of the Small Molecule Tool, [ |