No products
View larger AT20515L
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $177.65 | Total: $888.25 |
| 1 | 10 | $150.48 | Total: $1,504.80 |
| 1 | 25 | $127.49 | Total: $3,187.25 |
| 1 | 50 | $108.68 | Total: $5,434.00 |
| 1 | 100 | $94.05 | Total: $9,405.00 |
| Molecular Formula | C35H61N11O11 |
| Molecular Weight | 811.93 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | O=C([C@@H]1CCCN1C(CNC([C@@H]2CCCN2C([C@@H](NC([C@@H]3CCCN3C([C@@H](NC([C@H]([C@H](O)C)N)=O)CCCCN)=O)=O)CCCNC(N)=N)=O)=O)=O)O.OC(C)=O |
| References | Pavlov TS, Samonina GE, Bakaeva ZV, Zolotarev YA, Guseva AA. Selank and its metabolites maintain homeostasis in the gastric mucosa. Bull Exp Biol Med. 2007;143[1] 51-53. doi 10.1007s10517-007-0014-1 |