No products
View larger | Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $122.40 | Total: $612.00 |
| 1 | 10 | $103.68 | Total: $1,036.80 |
| 1 | 25 | $87.84 | Total: $2,196.00 |
| 1 | 50 | $74.88 | Total: $3,744.00 |
| 1 | 100 | $64.80 | Total: $6,480.00 |
| Molecular Formula | C51H96N18O15S |
| Molecular Weight | 1233.48 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CC(O)=O.O=C(N)CC[C@@H](C(O)=O)NC([C@H](C)NC([C@H](CC(N)=O)NC([C@H](CCCCN)NC([C@H](C)NC([C@H](C(C)C)NC([C@H](CCCCN)NC([C@H](CCSC)NC([C@H](CCCNC(N)=N)NC([C@H](CCCCN)N)=O)=O)=O)=O)=O)=O)=O)=O)=O |
| References | Ralph GS, Bienemann A, Ma J, Tan HK, Noel J, Henley JM, Uney JB. Disruption of the GluR2-NSF interaction protects primary hippocampal neurons from ischemic stress. Mol Cell Neurosci. 2001 Apr;17[4] 662-70. doi 10.1006mcne.2000.0959. PMID 11312602. |