No products
View larger ATN6767
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $142.80 | Total: $714.00 |
| 1 | 10 | $120.96 | Total: $1,209.60 |
| 1 | 25 | $102.48 | Total: $2,562.00 |
| 1 | 50 | $87.36 | Total: $4,368.00 |
| 1 | 100 | $75.60 | Total: $7,560.00 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 |
| CAS Numbers | 84638-55-1 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C(=C(C(O)=O)C)[C@H]1C=2[C@]([C@H](OC(C)=O)CC2C)([C@H](C)CC1)[H] |
| References | Gabriele Trauner, et al. Modulation of GABAA receptors by valerian extracts is related to the content of valerenic acid. Planta Med. 2008 Jan;74[1] 19-24. |