No products
View larger ATP1400L
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $36.55 | Total: $182.75 |
| 1 | 10 | $30.96 | Total: $309.60 |
| 1 | 25 | $26.23 | Total: $655.75 |
| 1 | 50 | $22.36 | Total: $1,118.00 |
| 1 | 100 | $19.35 | Total: $1,935.00 |
| Molecular Formula | C45H71N15O14S2 |
| Molecular Weight | 1110.27 |
| CAS Numbers | 74927-14-3 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CC[C@H]([C@H]1C(N[C@@H](CCC(N)=O)C(N[C@@H](CC(N)=O)C(N[C@H](C(N2CCC[C@H]2C(N[C@H](C(NCC(N)=O)=O)CCCN=C(N)N)=O)=O)CSSC[C@H](N)C(N[C@@H](CC3=CC=C(O)C=C3)C(N1)=O)=O)=O)=O)=O)C.CC(O)=O |
| References | Ingram CD, et al [Arg8]vasotocin excites neurones in the dorsal vagal complex in vitro evidence for an action through novel class[es] of CNS receptors. J Neuroendocrinol. 1994 Aug;6[4] 415-22. |