No products
View larger ATP1605L1
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $47.60 | Total: $238.00 |
| 1 | 10 | $40.32 | Total: $403.20 |
| 1 | 25 | $34.16 | Total: $854.00 |
| 1 | 50 | $29.12 | Total: $1,456.00 |
| 1 | 100 | $25.20 | Total: $2,520.00 |
| Molecular Formula | C47H69F3N12O14 |
| Molecular Weight | 1083.13 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | O=C(O)C(F)(F)F.CC(C)C[C@@H](C(N)=O)NC(CNC([C@H](CC1=CC=CC=C1)NC([C@H](CO)NC([C@H](CC2=CC=C(O)C=C2)NC([C@H](CC(C)C)NC([C@H](CCCNC(N)=N)NC([C@H](CC(O)=O)N)=O)=O)=O)=O)=O)=O)=O |
| References | Stay B, et al. The role of allatostatins in juvenile hormone synthesis in insects and crustaceans. Annu Rev Entomol. 2007;52 277-99. |