No products
View larger ATP1881L1
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $98.60 | Total: $493.00 |
| 1 | 10 | $83.52 | Total: $835.20 |
| 1 | 25 | $70.76 | Total: $1,769.00 |
| 1 | 50 | $60.32 | Total: $3,016.00 |
| 1 | 100 | $52.20 | Total: $5,220.00 |
| Molecular Formula | C83H113N17O24 |
| Molecular Weight | 1732.91 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C[C@@H](O)[C@H](NC(C)=O)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N)=O)C(C)C)=O)CC1=CNC2=CC=CC=C21)=O)CC(O)=O)=O)CC(C)C)=O)CC3=CC=C(O)C=C3)=O)CCC(O)=O)=O)CCC(O)=O)=O)CC4=CNC5=CC=CC=C54)=O)CO)=O)[C@H](O)C)=O)CC6=CC=CC=C6)=O)C(C)C)=O.N |
| References | Zhang et al [2014] Identification of a small peptide that inhibits PCSK9 protein binding to the low density lipoprotein receptor. J.Biol.Chem. 289 942 PMID |