No products
View larger | Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $185.30 | Total: $926.50 |
| 1 | 10 | $156.96 | Total: $1,569.60 |
| 1 | 25 | $132.98 | Total: $3,324.50 |
| 1 | 50 | $113.36 | Total: $5,668.00 |
| 1 | 100 | $98.10 | Total: $9,810.00 |
| Molecular Formula | C70H110N22O19S |
| Molecular Weight | 1595.82 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CC(O)=O.CSCC[C@@H](C(N)=O)NC([C@H](CC(C)C)NC([C@H](CC1=CNC=N1)NC(CNC([C@H](C(C)C)NC([C@H](C)NC([C@H](CC2=CNC3=C2C=CC=C3)NC([C@H](CCC(N)=O)NC([C@H]([C@H](O)C)NC(CNC([C@H](CC(C)C)NC([C@H](CCCNC(N)=N)NC(CNC([C@H](CC4)NC4=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O |
| References | Erspamer V, Erpamer GF, Inselvini M. Some pharmacological actions of alytesin and bombesin. J Pharm Pharmacol. 1970 Nov;22[11] 875-6. doi 10.1111j.2042-7158.1970.tb08465.x. PMID 4395815. |