No products
View larger AOB13855
CAS: 308277-46-5
Chemical Name: ZLc-002; Methyl (3-methoxy-3-oxopropanoyl)valinate
8000 Items
In stock
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $33.15 | Total: $165.75 |
| 1 | 10 | $28.08 | Total: $280.80 |
| 1 | 25 | $23.79 | Total: $594.75 |
| 1 | 50 | $20.28 | Total: $1,014.00 |
| 1 | 100 | $17.55 | Total: $1,755.00 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 |
| CAS Numbers | 308277-46-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | ZLc002; ZLc-002; ZLc 002 |
| IUPAC/Chemical Name | Methyl (3-methoxy-3-oxopropanoyl)valinate |
| InChl Key | BWPKYDAJBOUZDX-VIFPVBQESA-N |
| InChl Code | InChI=1S/C10H17NO5/c1-6(2)9(10(14)16-4)11-7(12)5-8(13)15-3/h6,9H,5H2,1-4H3,(H,11,12)/t9-/m0/s1 |
| SMILES Code | CC(C)[C@@H](C(OC)=O)NC(CC(OC)=O)=O |
| References | 1) Yajuan Qin et al., Neuroprotective Effect of N-Cyclohexylethyl-[A/G]-[D/E]-X-V Peptides on Ischemic Stroke by Blocking nNOS-CAPON Interaction, ACS Chem Neurosci. 2021 Jan 6;12(1):244-255. doi: 10.1021/acschemneuro.0c00739 |
Novel putative small molecule nNOS-NOS1AP inhibitor, suppressing inflammatory nociception and chemotherapy-induced neuropathic pain and synergizes with paclitaxel to reduce tumor cell viability