No products
View larger AT16566
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $27.20 | Total: $136.00 |
| 1 | 10 | $23.04 | Total: $230.40 |
| 1 | 25 | $19.52 | Total: $488.00 |
| 1 | 50 | $16.64 | Total: $832.00 |
| 1 | 100 | $14.40 | Total: $1,440.00 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.44 |
| CAS Numbers | 263717-53-9 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CCCc1c(nn(c1-c1ccc(O)cc1)-c1ccc(O)cc1)-c1ccc(O)cc1 |
| References | Influence of cellular ERalphaERbeta ratio on the ERalpha-agonist induced proliferation of human T47D breast cancer cells. |