No products
View larger AT9800
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $107.10 | Total: $535.50 |
| 1 | 10 | $90.72 | Total: $907.20 |
| 1 | 25 | $76.86 | Total: $1,921.50 |
| 1 | 50 | $65.52 | Total: $3,276.00 |
| 1 | 100 | $56.70 | Total: $5,670.00 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33 |
| CAS Numbers | 533883-77-1 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | OC=1C=C2[C@@]3([C@]([C@H](OC2=CC1)C4=CC=C(O)C=C4)(CCC3)[H])[H] |
| References | Coss Christopher Charles, et al. Estrogen receptor beta [ER?] agonists for the treatment of fibrotic conditions. WO2020160225A1 |