No products
View larger AT61111
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $36.55 | Total: $182.75 |
| 1 | 10 | $30.96 | Total: $309.60 |
| 1 | 25 | $26.23 | Total: $655.75 |
| 1 | 50 | $22.36 | Total: $1,118.00 |
| 1 | 100 | $19.35 | Total: $1,935.00 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.42 |
| CAS Numbers | 1515887-44-1 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | Cc1ccc(C)c(Cn2c(nc3ccccc23)C(O)c2ccncc2)c1 |
| References | O'Connell J, et al. Small molecules that inhibit TNF signalling by stabilising an asymmetric form of the trimer. Nat Commun. 2019;10[1] 5795. |