No products
View larger AOB0263
CAS: 165682-93-9
Chemical Name: 2-[(4-Chlorophenyl)amino]-4-thiazolecarboxylic acid ethyl ester
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $12.75 | Total: $63.75 |
| 1 | 10 | $10.80 | Total: $108.00 |
| 1 | 25 | $9.15 | Total: $228.75 |
| 1 | 50 | $7.80 | Total: $390.00 |
| 1 | 100 | $6.75 | Total: $675.00 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.74 |
| CAS Numbers | 165682-93-9 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | O4I2; O-4I2; O4I-2. |
| IUPAC/Chemical Name | ethyl 2-((4-chlorophenyl)amino)thiazole-4-carboxylate |
| InChl Key | ULUBAPWNHROTEU-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C12H11ClN2O2S/c1-2-17-11(16)10-7-18-12(15-10)14-9-5-3-8(13)4-6-9/h3-7H,2H2,1H3,(H,14,15) |
| SMILES Code | O=C(C1=CSC(NC2=CC=C(Cl)C=C2)=N1)OCC |
| References | 1) Cheng X, Yet al. Ethyl 2-((4-Chlorophenyl)amino)thiazole-4-carboxylate and Derivatives Are Potent Inducers of Oct3/4. J Med Chem. 2015 Aug 13;58(15):5742-50. |
Potent inducer of the Octamer-binding transcription factor 4 (Oct3/4)