No products
View larger AT9551
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $176.80 | Total: $884.00 |
| 1 | 10 | $149.76 | Total: $1,497.60 |
| 1 | 25 | $126.88 | Total: $3,172.00 |
| 1 | 50 | $108.16 | Total: $5,408.00 |
| 1 | 100 | $93.60 | Total: $9,360.00 |
| Molecular Formula | C22H30FNO14 |
| Molecular Weight | 551.47 |
| CAS Numbers | 117405-58-0 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C(OC)(=O)[C@@]1(OC(C)=O)O[C@@]([C@@H]([C@@H](COC(C)=O)OC(C)=O)OC(C)=O)([C@H](NC(C)=O)[C@@H](OC(C)=O)[C@H]1F)[H] |
| References | Gupta R, et al. Serine hydroxymethyl transferase 1 stimulates pro-oncogenic cytokine expression through sialic acid to promote ovarian cancer tumor growth and progression. Oncogene. 2017 Jul 13;36[28] 4014-4024. |