No products
View larger AOB2288
CAS No:1380782-27-3 (Free Base); 2138331-07-2
Chemical Name: (S)-4-(4-(2-Amino-3-hydroxypropyl)-2,6-diiodophenoxy)phenol hydrochloride, T2-aminoalcohol hydrochloride
500 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $12.75 | Total: $63.75 |
| 1 | 10 | $10.80 | Total: $108.00 |
| 1 | 25 | $9.15 | Total: $228.75 |
| 1 | 50 | $7.80 | Total: $390.00 |
| 1 | 100 | $6.75 | Total: $675.00 |
| Molecular Formula | C15H15I2NO3 · HCl |
| Molecular Weight | 547.55 |
| CAS Numbers | 1380782-27-3 (free base); 2138331-07-2 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | T2-amino Alcohol |
| IUPAC/Chemical Name | βS-amino-4-(4-hydroxyphenoxy)-3,5-diiodo-benzenepropanol, monohydrochloride |
| InChl Key | ILDRWUYIAXQKLH-PPHPATTJSA-N |
| InChl Code | InChI=1S/C15H15I2NO3.ClH/c16-13-6-9(5-10(18)8-19)7-14(17)15(13)21-12-3-1-11(20)2-4-12;/h1-4,6-7,10,19-20H,5,8,18H2;1H/t10-;/m0./s1 |
| SMILES Code | OC(C=C1)=CC=C1OC2=C(I)C=C(C[C@H](N)CO)C=C2I.Cl |
| References | 1) Punchihewa, C., Inoue, A., Hishiki, A., et al. Identification of small molecule proliferating cell nuclear antigen (PCNA) inhibitor that disrupts interactions with PIP-box proteins and inhibits DNA replication. The Journal of Biological Chemisty 287(17), 14289-14300 (2012). |
Novel Inhibitor of Monoubiquitinated Proliferating Cell Nuclear Antigen (PCNA), inhibiting Repair of Interstrand DNA Crosslink, enhancing DNA Double-strand Break, and sensitizing Cancer Cells to Cisplatin.