No products
View larger AOB6951
CAS No: 1026876-55-0
Chemical Name: AMG-7905; N-[6-[2-[(Cyclohexylmethyl)amino]-4-(trifluoromethyl)phenyl]-4-pyrimidinyl]-6-benzothiazolamine
1989 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.88 | Total: $159.38 |
| 1 | 10 | $27.00 | Total: $270.00 |
| 1 | 25 | $22.88 | Total: $571.88 |
| 1 | 50 | $19.50 | Total: $975.00 |
| 1 | 100 | $16.88 | Total: $1,687.50 |
| Molecular Formula | C16H15Br2N3O3 |
| Molecular Weight | 457.12 |
| CAS Numbers | 2054944-80-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | AMG7905; AMG-7905; AMG 7905; |
| IUPAC/Chemical Name | N-[6-[2-[(Cyclohexylmethyl)amino]-4-(trifluoromethyl)phenyl]-4-pyrimidinyl]-6-benzothiazolamine |
| InChl Key | HDEGHWQWPSXKSF-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C25H24F3N5S/c26-25(27,28)17-6-8-19(21(10-17)29-13-16-4-2-1-3-5-16)22-12-24(31-14-30-22)33-18-7-9-20-23(11-18)34-15-32-20/h6-12,14-16,29H,1-5,13H2,(H,30,31,33) |
| SMILES Code | FC(C1=CC=C(C2=CC(NC3=CC=C4N=CSC4=C3)=NC=N2)C(NCC5CCCCC5)=C1)(F)F |
| References | Garami A, Pakai E, McDonald HA, Reilly RM, Gomtsyan A, Corrigan JJ, Pinter E, Zhu DXD, Lehto SG, Gavva NR, Kym PR, Romanovsky AA. TRPV1 antagonists that cause hypothermia, instead of hyperthermia, in rodents: Compounds' pharmacological profiles, in vivo targets, thermoeffectors recruited and implications for drug development. Acta Physiol (Oxf). 2018 Jan 20. |
Novel transient receptor potential vanilloid type 1 modulator