No products
View larger AOB17003
CAS: 823830-85-9
Chemical Name: 3-((3,5-Bis(trifluoromethyl)phenyl)amino)benzo[d]isothiazole 1,1-dioxide
273 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $109.65 | Total: $548.25 |
| 1 | 10 | $92.88 | Total: $928.80 |
| 1 | 25 | $78.69 | Total: $1,967.25 |
| 1 | 50 | $67.08 | Total: $3,354.00 |
| 1 | 100 | $58.05 | Total: $5,805.00 |
| Molecular Formula | C15H8F6N2O2S |
| Molecular Weight | 394.29 |
| CAS Numbers | 823830-85-9 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | M1002; M 1002; M-1002 |
| IUPAC/Chemical Name | 3-((3,5-Bis(trifluoromethyl)phenyl)amino)benzo[d]isothiazole 1,1-dioxide |
| InChl Key | BMTRZTPPTZHACH-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C15H8F6N2O2S/c16-14(17,18)8-5-9(15(19,20)21)7-10(6-8)22-13-11-3-1-2-4-12(11)26(24,25)23-13/h1-7H,(H,22,23) |
| SMILES Code | FC(C1=CC(C(F)(F)F)=CC(NC(C2=CC=CC=C23)=NS3(=O)=O)=C1)(F)F |
| References | D Wu et al.; Bidirectional Modulation of HIF-2 Activity through Chemical Ligands; Nat Chem Biol. 2019 Apr; 15(4): 367–376.doi: 10.1038/s41589-019-0234-5 |
Novel allosteric agonist of hypoxia-inducible factor-2α subunit (HIF-2α), significantly displacing pocket residue Y281