No products
View larger AOB1711
CAS No: 474432-66-1
Chemical Name: Benzo[b]thiophene-2-carboxylic acid {4-[4-(2,3-dichloro-phenyl)-piperazin-1-yl]-butyl}-amide
319 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $12.75 | Total: $63.75 |
| 1 | 10 | $10.80 | Total: $108.00 |
| 1 | 25 | $9.15 | Total: $228.75 |
| 1 | 50 | $7.80 | Total: $390.00 |
| 1 | 100 | $6.75 | Total: $675.00 |
| Molecular Formula | C23H25Cl2N3OS |
| Molecular Weight | 462.44 |
| CAS Numbers | 474432-66-1 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | FAUC-365; FAUC 365; FAUC365; |
| IUPAC/Chemical Name | N-[4-[4-(2,3-dichlorophenyl)-1-piperazinyl]butyl]-benzo[b]thiophene-2-carboxamide |
| InChl Key | CPTSTFKVXWZGEV-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C23H25Cl2N3OS/c24-18-7-5-8-19(22(18)25)28-14-12-27(13-15-28)11-4-3-10-26-23(29)21-16-17-6-1-2-9-20(17)30-21/h1-2,5-9,16H,3-4,10-15H2,(H,26,29) |
| SMILES Code | ClC1=C(Cl)C(N2CCN(CCCCNC(C3=CC4=C(C=CC=C4)S3)=O)CC2)=CC=C1 |
| References | 1) Chang, P.-K., Yu, L., and Chen, J.-C. Dopamine D3 receptor blockade rescues hyper-dopamine activity-induced deficit in novel object recognition memory. Neuropharmacology 133, 216-223 (2018). 2) Bettinetti, L., Schlotter, K., Hübner, H., et al. Interactive SAR studies: Rational discovery of super-potent and highly selective dopamine D3 receptor antagonists and partial agonists. J. Med. Chem. 45(21), 4594-4597 (2002). |
Super-potent and highly selective dopamine D3 receptor antagonist