No products
View larger AOB13823
CAS: 907559-59-5 (x-hydrate); 302566-08-1 (anhydrous)
Chemical Name: ZFL; Benzyl ((S)-1-(((S)-1,1-Dihydroxy-5-methyl-2-oxohexan-3-yl)amino)-1-oxo-3-phenylpropan-2-yl)carbamate
954 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $24.65 | Total: $123.25 |
| 1 | 10 | $20.88 | Total: $208.80 |
| 1 | 25 | $17.69 | Total: $442.25 |
| 1 | 50 | $15.08 | Total: $754.00 |
| 1 | 100 | $13.05 | Total: $1,305.00 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 |
| CAS Numbers | CAS: 907559-59-5 (x-hydrate); 302566-08-1 (anhydrous) |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | ZFL |
| IUPAC/Chemical Name | Benzyl ((S)-1-(((S)-1,1-Dihydroxy-5-methyl-2-oxohexan-3-yl)amino)-1-oxo-3-phenylpropan-2-yl)carbamate |
| InChl Key | BKUIZWILNWHFHD-UHFFFAOYSA-N |
| SMILES Code | O=C(C4=CC(C#N)=CC=C4)NC1=CC(C3=CC=CC=C3)=NN1C2=CC=CC=C2 |
| References | 1) Seo, SU et al., Z-FL-COCHO, a cathepsin S inhibitor, enhances oxaliplatin-induced apoptosis through upregulation of Bim expression, Biochemical and Biophysical Research Communications Volume 498, Issue 4, 15 April 2018, Pages 849-854 |
| PubChem ID | 11245456 |
Novel cathepsin S inhibitor, enhancing oxaliplatin-induced apoptosis through upregulation of Bim expression